cas: 5337-09-7 — see every product listed under this CAS number, including other names
Methyl 2-bromo-3-nitrobenzoate, 96% (CAS 5337-09-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212287-1G |
| cas | 5337-09-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 10g | 419.66 Pln | |
| Fluorochem | 25g | 862.21 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 2-bromo-3-nitrobenzoate (CAS 5337-09-7) is a chemical compound with the molecular formula C8H6BrNO4 and a molecular weight of 260.04 g/mol. IUPAC name: methyl 2-bromo-3-nitrobenzoate. InChIKey: YUWPKYJCYRFBJT-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO4 |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | methyl 2-bromo-3-nitrobenzoate |
| InChIKey | YUWPKYJCYRFBJT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)