cas: 5337-09-7 — see every product listed under this CAS number, including other names
Methyl 2-bromo-3-nitrobenzoate, 97%, 97% (CAS 5337-09-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140VH-250mg |
| cas | 5337-09-7 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 285.20 Pln | |
| Chemat | 10g | 434.00 Pln | |
| Chemat | 25g | 798.80 Pln | |
| Chemat | 100g | 2862.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-bromo-3-nitrobenzoate (CAS 5337-09-7) is a chemical compound with the molecular formula C8H6BrNO4 and a molecular weight of 260.04 g/mol. IUPAC name: methyl 2-bromo-3-nitrobenzoate. InChIKey: YUWPKYJCYRFBJT-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO4 |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | methyl 2-bromo-3-nitrobenzoate |
| InChIKey | YUWPKYJCYRFBJT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)