CAS 6942-36-5 appears in our catalog under these names: Methyl 2–bromo–5–nitrobenzoate, Methyl 2-bromo-5-nitrobenzoate, 98+% , Methyl 2-bromo-5-nitrobenzoate 97%, Methyl 2-bromo-5-nitrobenzoate, 97%, Methyl 2-Bromo-5-nitrobenzoate, >98.0%(GC). Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem, TCI. Available pack sizes: 100g, 25g, 5g, 1000g, 1g, 10g, 500g, 1kg.
Methyl 2-bromo-5-nitrobenzoate (CAS 6942-36-5) is a chemical compound with the molecular formula C8H6BrNO4 and a molecular weight of 260.04 g/mol. IUPAC name: methyl 2-bromo-5-nitrobenzoate. InChIKey: VSEYYEKRZNRECT-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO4 |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | methyl 2-bromo-5-nitrobenzoate |
| InChIKey | VSEYYEKRZNRECT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)