CAS 156573-32-9 appears in our catalog under these names: Methyl 2-chloro-4-iodobenzoate, 98%, Methyl 2–Chloro–4–iodobenzoate, Methyl 2-chloro-4-iodobenzoate, 97%, 97%, Methyl 2-chloro-4-iodobenzoate, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg, 25g, 100g.
Methyl 2-chloro-4-iodobenzoate (CAS 156573-32-9) is a chemical compound with the molecular formula C8H6ClIO2 and a molecular weight of 296.49 g/mol. IUPAC name: methyl 2-chloro-4-iodobenzoate. InChIKey: GXZQAHOVNZHGFE-UHFFFAOYSA-N.
| Molecular formula | C8H6ClIO2 |
|---|---|
| Molecular weight | 296.49 g/mol |
| IUPAC name | methyl 2-chloro-4-iodobenzoate |
| InChIKey | GXZQAHOVNZHGFE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)I)Cl |
Computed by PubChem (NCBI)