Products 1399182-03-6
CAS 1399182-03-6 is the registry number for 4-Chloro-5-iodo-2-methyl-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
4-chloro-5-iodo-2-methylbenzoic acid (CAS 1399182-03-6) is a chemical compound with the molecular formula C8H6ClIO2 and a molecular weight of 296.49 g/mol. IUPAC name: 4-chloro-5-iodo-2-methylbenzoic acid. InChIKey: JFISQRPYNOQTAD-UHFFFAOYSA-N.
| Molecular formula | C8H6ClIO2 |
|---|---|
| Molecular weight | 296.49 g/mol |
| IUPAC name | 4-chloro-5-iodo-2-methylbenzoic acid |
| InChIKey | JFISQRPYNOQTAD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)O)I)Cl |
Computed by PubChem (NCBI)