CAS 181765-85-5 appears in our catalog under these names: methyl 4–chloro–2–iodobenzoate, Methyl 4-chloro-2-iodobenzoate, Methyl 4-chloro-2-iodobenzoate 97%, Methyl 4-chloro-2-iodobenzoate, 98%, 98%, Methyl 4-chloro-2-iodobenzoate, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g, 100g.
Methyl 4-chloro-2-iodobenzoate (CAS 181765-85-5) is a chemical compound with the molecular formula C8H6ClIO2 and a molecular weight of 296.49 g/mol. IUPAC name: methyl 4-chloro-2-iodobenzoate. InChIKey: SPEFZJXZNVTFJX-UHFFFAOYSA-N.
| Molecular formula | C8H6ClIO2 |
|---|---|
| Molecular weight | 296.49 g/mol |
| IUPAC name | methyl 4-chloro-2-iodobenzoate |
| InChIKey | SPEFZJXZNVTFJX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Cl)I |
Computed by PubChem (NCBI)