CAS 289039-82-3 appears in our catalog under these names: Methyl 5-chloro-2-iodobenzoate, 95%, Methyl 5–chloro–2–iodobenzoate, Methyl 5-chloro-2-iodobenzoate 95%, Benzoic acid,5-chloro-2-iodo-, methyl ester, 95%, 95%, Methyl 5-chloro-2-iodobenzoate, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 250mg, 500g, 100mg, 10g.
Methyl 5-chloro-2-iodobenzoate (CAS 289039-82-3) is a chemical compound with the molecular formula C8H6ClIO2 and a molecular weight of 296.49 g/mol. IUPAC name: methyl 5-chloro-2-iodobenzoate. InChIKey: LNCNRPALSKTJBG-UHFFFAOYSA-N.
| Molecular formula | C8H6ClIO2 |
|---|---|
| Molecular weight | 296.49 g/mol |
| IUPAC name | methyl 5-chloro-2-iodobenzoate |
| InChIKey | LNCNRPALSKTJBG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Cl)I |
Computed by PubChem (NCBI)