CAS 1048025-62-2 appears in our catalog under these names: 4-Chloro-2-iodo-6-methylbenzoic acid, 98%, 4-CHLORO-2-IODO-6-METHYLBENZOIC ACID, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
4-chloro-2-iodo-6-methylbenzoic acid (CAS 1048025-62-2) is a chemical compound with the molecular formula C8H6ClIO2 and a molecular weight of 296.49 g/mol. IUPAC name: 4-chloro-2-iodo-6-methylbenzoic acid. InChIKey: DRYFFNYQTYAJIE-UHFFFAOYSA-N.
| Molecular formula | C8H6ClIO2 |
|---|---|
| Molecular weight | 296.49 g/mol |
| IUPAC name | 4-chloro-2-iodo-6-methylbenzoic acid |
| InChIKey | DRYFFNYQTYAJIE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)O)I)Cl |
Computed by PubChem (NCBI)