Methyl 2-chloro-5-(trifluoromethyl)nicotinate 98%
cas: 1360934-51-5 — see every product listed under this CAS number, including other names
Methyl 2-chloro-5-(trifluoromethyl)nicotinate 98% (CAS 1360934-51-5) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A498555-500g |
| cas | 1360934-51-5 |
| size | 500g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 11801.31 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 10g | 464.94 Pln | |
| Ambeed | 25g | 987.81 Pln | |
| Ambeed | 100g | 3001.44 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A498555 |
Methyl 2-chloro-5-(trifluoromethyl)pyridine-3-carboxylate (CAS 1360934-51-5) is a chemical compound with the molecular formula C8H5ClF3NO2 and a molecular weight of 239.58 g/mol. IUPAC name: methyl 2-chloro-5-(trifluoromethyl)pyridine-3-carboxylate. InChIKey: ABTMVRRTSDJRGO-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO2 |
|---|---|
| Molecular weight | 239.58 g/mol |
| IUPAC name | methyl 2-chloro-5-(trifluoromethyl)pyridine-3-carboxylate |
| InChIKey | ABTMVRRTSDJRGO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=CC(=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)