Methyl 2-chlorobenzo[d]thiazole-5-carboxylate, 95%
cas: 90225-03-9 — see every product listed under this CAS number, including other names
Methyl 2-chlorobenzo[d]thiazole-5-carboxylate, 95% (CAS 90225-03-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1961826-100mg |
| cas | 90225-03-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 364.81 Pln | |
| Ambeed | 250mg | 665.19 Pln | |
| Ambeed | 1g | 2089.19 Pln | |
| Ambeed | 5g | 7145.50 Pln | |
| BLDpharm | 100mg | 358.79 Pln | |
| BLDpharm | 250mg | 658.68 Pln | |
| BLDpharm | 1g | 2052.64 Pln | |
| BLDpharm | 5g | 7000.89 Pln | |
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 602.00 Pln | |
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 6088.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 2-chloro-1,3-benzothiazole-5-carboxylate (CAS 90225-03-9) is a chemical compound with the molecular formula C9H6ClNO2S and a molecular weight of 227.67 g/mol. IUPAC name: methyl 2-chloro-1,3-benzothiazole-5-carboxylate. InChIKey: BYLOHEPCHOXXGW-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2S |
|---|---|
| Molecular weight | 227.67 g/mol |
| IUPAC name | methyl 2-chloro-1,3-benzothiazole-5-carboxylate |
| InChIKey | BYLOHEPCHOXXGW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)SC(=N2)Cl |
Computed by PubChem (NCBI)