Products 152149-00-3
CAS 152149-00-3 appears in our catalog under these names: (2-Chloro-benzothiazol-6-yl)-acetic acid, 95%, 2-(2-Chlorobenzo(d)thiazol-6-yl)acetic acid, 98%, (2-Chloro-benzothiazol-6-yl)-acetic acid, (2-Chloro-benzothiazol-6-yl)-acetic acid, 96%, 96%, 2-(2-Chlorobenzo[d]thiazol-6-yl)acetic acid, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 0,5g, 100mg.
2-(2-chloro-1,3-benzothiazol-6-yl)acetic acid (CAS 152149-00-3) is a chemical compound with the molecular formula C9H6ClNO2S and a molecular weight of 227.67 g/mol. IUPAC name: 2-(2-chloro-1,3-benzothiazol-6-yl)acetic acid. InChIKey: HBDVBZKFZBCJEW-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2S |
|---|---|
| Molecular weight | 227.67 g/mol |
| IUPAC name | 2-(2-chloro-1,3-benzothiazol-6-yl)acetic acid |
| InChIKey | HBDVBZKFZBCJEW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CC(=O)O)SC(=N2)Cl |
Computed by PubChem (NCBI)