Products 1936482-80-2

CAS 1936482-80-2 is the registry number for 2-Chloro-3-thiocyanato-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2-chloro-3-thiocyanatobenzoate (CAS 1936482-80-2) is a chemical compound with the molecular formula C9H6ClNO2S and a molecular weight of 227.67 g/mol. IUPAC name: methyl 2-chloro-3-thiocyanatobenzoate. InChIKey: OWKHRTZLMJOMKO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6ClNO2S
Molecular weight227.67 g/mol
IUPAC namemethyl 2-chloro-3-thiocyanatobenzoate
InChIKeyOWKHRTZLMJOMKO-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C(=CC=C1)SC#N)Cl

Computed by PubChem (NCBI)