Products 342623-32-9
CAS 342623-32-9 appears in our catalog under these names: methyl 5-chloro-2-isothiocyanatobenzoate, 95%, Methyl 5-chloro-2-isothiocyanatobenzoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 50mg, 0,5g.
Methyl 5-chloro-2-isothiocyanatobenzoate (CAS 342623-32-9) is a chemical compound with the molecular formula C9H6ClNO2S and a molecular weight of 227.67 g/mol. IUPAC name: methyl 5-chloro-2-isothiocyanatobenzoate. InChIKey: DDZWTFVIWHBHTJ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2S |
|---|---|
| Molecular weight | 227.67 g/mol |
| IUPAC name | methyl 5-chloro-2-isothiocyanatobenzoate |
| InChIKey | DDZWTFVIWHBHTJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Cl)N=C=S |
Computed by PubChem (NCBI)