Products 1208225-86-8
CAS 1208225-86-8 appears in our catalog under these names: Methyl 2-chlorobenzo[d]thiazole-4-carboxylate, 95%, Methyl 2-chlorobenzo(d)thiazole-4-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 100mg.
Methyl 2-chloro-1,3-benzothiazole-4-carboxylate (CAS 1208225-86-8) is a chemical compound with the molecular formula C9H6ClNO2S and a molecular weight of 227.67 g/mol. IUPAC name: methyl 2-chloro-1,3-benzothiazole-4-carboxylate. InChIKey: WGQADQNXJQHAOI-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2S |
|---|---|
| Molecular weight | 227.67 g/mol |
| IUPAC name | methyl 2-chloro-1,3-benzothiazole-4-carboxylate |
| InChIKey | WGQADQNXJQHAOI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC=C1)SC(=N2)Cl |
Computed by PubChem (NCBI)