Methyl 2-iodo-4-methoxybenzoate, 95%
cas: 54413-84-2 — see every product listed under this CAS number, including other names
Methyl 2-iodo-4-methoxybenzoate, 95% (CAS 54413-84-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A443740-250mg |
| cas | 54413-84-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 626.25 Pln | |
| Ambeed | 25g | 2078.06 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 242.16 Pln | |
| BLDpharm | 5g | 669.79 Pln | |
| BLDpharm | 25g | 2235.90 Pln | |
| Fluorochem | 250mg | 102.06 Pln | |
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 617.51 Pln | |
| Fluorochem | 25g | 2070.12 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 2-iodo-4-methoxybenzoate (CAS 54413-84-2) is a chemical compound with the molecular formula C9H9IO3 and a molecular weight of 292.07 g/mol. IUPAC name: methyl 2-iodo-4-methoxybenzoate. InChIKey: VCRNSLCBMOIYEN-UHFFFAOYSA-N.
| Molecular formula | C9H9IO3 |
|---|---|
| Molecular weight | 292.07 g/mol |
| IUPAC name | methyl 2-iodo-4-methoxybenzoate |
| InChIKey | VCRNSLCBMOIYEN-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)OC)I |
Computed by PubChem (NCBI)