CAS 40757-09-3 appears in our catalog under these names: Methyl 5-iodo-2-methoxybenzoate, 95%, Methyl 5–iodo–2–methoxybenzoate, Methyl 5-iodo-2-methoxybenzoate 97%, Methyl 5-iodo-2-methoxybenzoate, 97%, 97%, Methyl 5-iodo-2-methoxybenzoate, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 25g, 100g, 50g, 10g.
Methyl 5-iodo-2-methoxybenzoate (CAS 40757-09-3) is a chemical compound with the molecular formula C9H9IO3 and a molecular weight of 292.07 g/mol. IUPAC name: methyl 5-iodo-2-methoxybenzoate. InChIKey: FJVKSHACIRATIW-UHFFFAOYSA-N.
| Molecular formula | C9H9IO3 |
|---|---|
| Molecular weight | 292.07 g/mol |
| IUPAC name | methyl 5-iodo-2-methoxybenzoate |
| InChIKey | FJVKSHACIRATIW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)I)C(=O)OC |
Computed by PubChem (NCBI)