CAS 148490-97-5 appears in our catalog under these names: Methyl 4-iodo-2-methoxybenzoate, 98%, Methyl 4-iodo-2-methoxybenzoate, 98+% , 4-Iodo-2-methoxybenzoic acid methyl ester, Methyl 4-iodo-2-methoxybenzoate, 98%, 98%, Methyl 4-iodo-2-methoxybenzoate, 96%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 10g, 50g, 250g, 100g, 250mg.
Methyl 4-iodo-2-methoxybenzoate (CAS 148490-97-5) is a chemical compound with the molecular formula C9H9IO3 and a molecular weight of 292.07 g/mol. IUPAC name: methyl 4-iodo-2-methoxybenzoate. InChIKey: MCNOTXROWOGSGU-UHFFFAOYSA-N.
| Molecular formula | C9H9IO3 |
|---|---|
| Molecular weight | 292.07 g/mol |
| IUPAC name | methyl 4-iodo-2-methoxybenzoate |
| InChIKey | MCNOTXROWOGSGU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)I)C(=O)OC |
Computed by PubChem (NCBI)