CAS 15126-07-5 appears in our catalog under these names: Ethyl 4-hydroxy-3-iodobenzoate, 95%, Ethyl 4-hydroxy-3-iodobenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 250mg, 25g.
Ethyl 4-hydroxy-3-iodobenzoate (CAS 15126-07-5) is a chemical compound with the molecular formula C9H9IO3 and a molecular weight of 292.07 g/mol. IUPAC name: ethyl 4-hydroxy-3-iodobenzoate. InChIKey: HOAXKZYYZXASLJ-UHFFFAOYSA-N.
| Molecular formula | C9H9IO3 |
|---|---|
| Molecular weight | 292.07 g/mol |
| IUPAC name | ethyl 4-hydroxy-3-iodobenzoate |
| InChIKey | HOAXKZYYZXASLJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)O)I |
Computed by PubChem (NCBI)