Products 1379337-67-3

CAS 1379337-67-3 is the registry number for Methyl 2-iodo-6-methoxybenzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2-iodo-6-methoxybenzoate (CAS 1379337-67-3) is a chemical compound with the molecular formula C9H9IO3 and a molecular weight of 292.07 g/mol. IUPAC name: methyl 2-iodo-6-methoxybenzoate. InChIKey: UKQWVJWPFLNUPQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9IO3
Molecular weight292.07 g/mol
IUPAC namemethyl 2-iodo-6-methoxybenzoate
InChIKeyUKQWVJWPFLNUPQ-UHFFFAOYSA-N
SMILESCOC1=C(C(=CC=C1)I)C(=O)OC

Computed by PubChem (NCBI)