CAS 1379337-67-3 is the registry number for Methyl 2-iodo-6-methoxybenzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl 2-iodo-6-methoxybenzoate (CAS 1379337-67-3) is a chemical compound with the molecular formula C9H9IO3 and a molecular weight of 292.07 g/mol. IUPAC name: methyl 2-iodo-6-methoxybenzoate. InChIKey: UKQWVJWPFLNUPQ-UHFFFAOYSA-N.
| Molecular formula | C9H9IO3 |
|---|---|
| Molecular weight | 292.07 g/mol |
| IUPAC name | methyl 2-iodo-6-methoxybenzoate |
| InChIKey | UKQWVJWPFLNUPQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)I)C(=O)OC |
Computed by PubChem (NCBI)