cas: 179950-69-7 — see every product listed under this CAS number, including other names
Methyl 2-methyl-3-oxo-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylate, 98%, 98% (CAS 179950-69-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1132J3-100mg |
| cas | 179950-69-7 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 525.20 Pln | |
| Chemat | 5g | 1619.60 Pln | |
| Chemat | 10g | 2738.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-methyl-3-oxo-4H-1,4-benzoxazine-7-carboxylate (CAS 179950-69-7) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: methyl 2-methyl-3-oxo-4H-1,4-benzoxazine-7-carboxylate. InChIKey: OLLPWCOGKLTZEW-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | methyl 2-methyl-3-oxo-4H-1,4-benzoxazine-7-carboxylate |
| InChIKey | OLLPWCOGKLTZEW-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC2=C(O1)C=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)