cas: 179950-69-7 — see every product listed under this CAS number, including other names
Methyl 2-methyl-3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-7-carboxylate, 98% (CAS 179950-69-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F441815-250MG |
| cas | 179950-69-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 331.15 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 1185.02 Pln | |
| Fluorochem | 10g | 2309.62 Pln | |
| Fluorochem | 25g | 4730.64 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-methyl-3-oxo-4H-1,4-benzoxazine-7-carboxylate (CAS 179950-69-7) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: methyl 2-methyl-3-oxo-4H-1,4-benzoxazine-7-carboxylate. InChIKey: OLLPWCOGKLTZEW-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | methyl 2-methyl-3-oxo-4H-1,4-benzoxazine-7-carboxylate |
| InChIKey | OLLPWCOGKLTZEW-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC2=C(O1)C=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)