cas: 943112-78-5 — see every product listed under this CAS number, including other names
Methyl 2-methylimidazo[1,2-a]pyridine-3-carboxylate, 95%, 95% (CAS 943112-78-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11II2S-100mg |
| cas | 943112-78-5 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 357.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-methylimidazo[1,2-a]pyridine-3-carboxylate (CAS 943112-78-5) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: methyl 2-methylimidazo[1,2-a]pyridine-3-carboxylate. InChIKey: LRDHMQIRNWVJTH-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | methyl 2-methylimidazo[1,2-a]pyridine-3-carboxylate |
| InChIKey | LRDHMQIRNWVJTH-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C=CC=CC2=N1)C(=O)OC |
Computed by PubChem (NCBI)