cas: 24093-81-0 — see every product listed under this CAS number, including other names
Methyl 3,5-Dihydroxy-4-methoxybenzoate, 98%, 98% (CAS 24093-81-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CCIO-250mg |
| cas | 24093-81-0 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 837.20 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 10g | 1590.80 Pln | |
| Chemat | 25g | 3822.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 3,5-dihydroxy-4-methoxybenzoate (CAS 24093-81-0) is a chemical compound with the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. IUPAC name: methyl 3,5-dihydroxy-4-methoxybenzoate. InChIKey: SUGIJIFASYORQN-UHFFFAOYSA-N.
| Molecular formula | C9H10O5 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | methyl 3,5-dihydroxy-4-methoxybenzoate |
| InChIKey | SUGIJIFASYORQN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1O)C(=O)OC)O |
Computed by PubChem (NCBI)