cas: 24093-81-0 — see every product listed under this CAS number, including other names
Methyl 3,5-dihydroxy-4-methoxybenzoate, 98% (CAS 24093-81-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F624239-250MG |
| cas | 24093-81-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 378.01 Pln | |
| Fluorochem | 5g | 1601.54 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 3,5-dihydroxy-4-methoxybenzoate (CAS 24093-81-0) is a chemical compound with the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. IUPAC name: methyl 3,5-dihydroxy-4-methoxybenzoate. InChIKey: SUGIJIFASYORQN-UHFFFAOYSA-N.
| Molecular formula | C9H10O5 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | methyl 3,5-dihydroxy-4-methoxybenzoate |
| InChIKey | SUGIJIFASYORQN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1O)C(=O)OC)O |
Computed by PubChem (NCBI)