cas: 64277-87-8 — see every product listed under this CAS number, including other names
Methyl 3,5-di-tert-butylbenzoate 98% (CAS 64277-87-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A614167-5g |
| cas | 64277-87-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 409.31 Pln | |
| Ambeed | 10g | 654.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A614167 |
Methyl 3,5-ditert-butylbenzoate (CAS 64277-87-8) is a chemical compound with the molecular formula C16H24O2 and a molecular weight of 248.36 g/mol. IUPAC name: methyl 3,5-ditert-butylbenzoate. InChIKey: ZEIOQJMJXFVPOG-UHFFFAOYSA-N.
| Molecular formula | C16H24O2 |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | methyl 3,5-ditert-butylbenzoate |
| InChIKey | ZEIOQJMJXFVPOG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)C(=O)OC)C(C)(C)C |
Computed by PubChem (NCBI)