cas: 64277-87-8 — see every product listed under this CAS number, including other names
Methyl 3,5-di-tert-butylbenzoate (CAS 64277-87-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F606035-250MG |
| cas | 64277-87-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 227.02 Pln | |
| Fluorochem | 5g | 752.88 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 3,5-ditert-butylbenzoate (CAS 64277-87-8) is a chemical compound with the molecular formula C16H24O2 and a molecular weight of 248.36 g/mol. IUPAC name: methyl 3,5-ditert-butylbenzoate. InChIKey: ZEIOQJMJXFVPOG-UHFFFAOYSA-N.
| Molecular formula | C16H24O2 |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | methyl 3,5-ditert-butylbenzoate |
| InChIKey | ZEIOQJMJXFVPOG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)C(=O)OC)C(C)(C)C |
Computed by PubChem (NCBI)