cas: 3934-86-9 — see every product listed under this CAS number, including other names
Methyl 3,4-dihydroxy-5-methoxybenzoate, 95%, 95% (CAS 3934-86-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BY8Q-25g |
| cas | 3934-86-9 |
| size | 25g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 4816.40 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 510.80 Pln | |
| Chemat | 5g | 1418.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 3,4-dihydroxy-5-methoxybenzoate (CAS 3934-86-9) is a chemical compound with the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. IUPAC name: methyl 3,4-dihydroxy-5-methoxybenzoate. InChIKey: LVVUKXKEXOTUPV-UHFFFAOYSA-N.
| Molecular formula | C9H10O5 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | methyl 3,4-dihydroxy-5-methoxybenzoate |
| InChIKey | LVVUKXKEXOTUPV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1O)O)C(=O)OC |
Computed by PubChem (NCBI)