CAS 3934-86-9 appears in our catalog under these names: 3,4-Dihydroxy-5-methoxybenzoic acid methyl ester, 95%, Methyl 3-O-methylgallate/ 98.22% (existing batch purity), Methyl 3–O–methylgallate, Methyl 3-O-methylgallate 95%, Methyl 3,4-dihydroxy-5-methoxybenzoate, 95%, 95%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Fluorochem. Available pack sizes: 5g, 25g, 1g, 500mg, 100mg, 250mg, 10mM/1mL, 50 mg.
Methyl 3,4-dihydroxy-5-methoxybenzoate (CAS 3934-86-9) is a chemical compound with the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. IUPAC name: methyl 3,4-dihydroxy-5-methoxybenzoate. InChIKey: LVVUKXKEXOTUPV-UHFFFAOYSA-N.
| Molecular formula | C9H10O5 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | methyl 3,4-dihydroxy-5-methoxybenzoate |
| InChIKey | LVVUKXKEXOTUPV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1O)O)C(=O)OC |
Computed by PubChem (NCBI)