cas: 1363381-38-7 — see every product listed under this CAS number, including other names
Methyl 3-((tert-butoxycarbonyl)amino)oxetane-3-carboxylate 95% (CAS 1363381-38-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A419157-250mg |
| cas | 1363381-38-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 470.50 Pln | |
| Ambeed | 1g | 1060.12 Pln | |
| Ambeed | 5g | 3034.81 Pln | |
| Ambeed | 100mg | 370.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A419157 |
Methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]oxetane-3-carboxylate (CAS 1363381-38-7) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]oxetane-3-carboxylate. InChIKey: GWYLPDSCEUAFEZ-UHFFFAOYSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]oxetane-3-carboxylate |
| InChIKey | GWYLPDSCEUAFEZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(COC1)C(=O)OC |
Computed by PubChem (NCBI)