CAS 72072-06-1 appears in our catalog under these names: N-Boc-5-aminolevulinic acid, 95%, 5–((tert–Butoxycarbonyl)amino)–4–oxopentanoic acid, 5-((tert-Butoxycarbonyl)amino)-4-oxopentanoic acid 96%, 5-((tert-Butoxycarbonyl)amino)-4-oxopentanoic acid, 96%, 96%, 5-((tert-Butoxycarbonyl)amino)-4-oxopentanoic acid, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg.
5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoic acid (CAS 72072-06-1) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: 5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoic acid. InChIKey: DKLUNXGTJHDHIV-UHFFFAOYSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoic acid |
| InChIKey | DKLUNXGTJHDHIV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(=O)CCC(=O)O |
Computed by PubChem (NCBI)