cas: 146381-88-6 — see every product listed under this CAS number, including other names
Methyl 3-(2-chloroacetamido)thiophene-2-carboxylate, 97%, 97% (CAS 146381-88-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AD35-250mg |
| cas | 146381-88-6 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 827.60 Pln | |
| Chemat | 5g | 2944.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-[(2-chloroacetyl)amino]thiophene-2-carboxylate (CAS 146381-88-6) is a chemical compound with the molecular formula C8H8ClNO3S and a molecular weight of 233.67 g/mol. IUPAC name: methyl 3-[(2-chloroacetyl)amino]thiophene-2-carboxylate. InChIKey: UQIQUQQCIXVKLY-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3S |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | methyl 3-[(2-chloroacetyl)amino]thiophene-2-carboxylate |
| InChIKey | UQIQUQQCIXVKLY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CS1)NC(=O)CCl |
Computed by PubChem (NCBI)