cas: 185302-86-7 — see every product listed under this CAS number, including other names
Methyl 3-(2-fluorophenyl)-3-oxopropanoate 95% (CAS 185302-86-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A722004-1g |
| cas | 185302-86-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 181.25 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 25g | 615.13 Pln | |
| Ambeed | 100g | 2206.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A722004 |
Methyl 3-(2-fluorophenyl)-3-oxopropanoate (CAS 185302-86-7) is a chemical compound with the molecular formula C10H9FO3 and a molecular weight of 196.17 g/mol. IUPAC name: methyl 3-(2-fluorophenyl)-3-oxopropanoate. InChIKey: HVFIYFIBZJWQAE-UHFFFAOYSA-N.
| Molecular formula | C10H9FO3 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | methyl 3-(2-fluorophenyl)-3-oxopropanoate |
| InChIKey | HVFIYFIBZJWQAE-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)C1=CC=CC=C1F |
Computed by PubChem (NCBI)