cas: 24807-40-7 — see every product listed under this CAS number, including other names
Methyl 3-(4-(benzyloxy)phenyl)propanoate 95% (CAS 24807-40-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A233883-1g |
| cas | 24807-40-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 520.56 Pln | |
| Ambeed | 10g | 932.19 Pln | |
| Ambeed | 25g | 1855.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A233883 |
Methyl 3-(4-phenylmethoxyphenyl)propanoate (CAS 24807-40-7) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: methyl 3-(4-phenylmethoxyphenyl)propanoate. InChIKey: XAAMAAXKDLWBKO-UHFFFAOYSA-N.
| Molecular formula | C17H18O3 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | methyl 3-(4-phenylmethoxyphenyl)propanoate |
| InChIKey | XAAMAAXKDLWBKO-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC1=CC=C(C=C1)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)