cas: 24807-40-7 — see every product listed under this CAS number, including other names
Methyl 3-(4-(benzyloxy)phenyl)propanoate, ≥95%, ≥95% (CAS 24807-40-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113PHV-250mg |
| cas | 24807-40-7 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 779.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-(4-phenylmethoxyphenyl)propanoate (CAS 24807-40-7) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: methyl 3-(4-phenylmethoxyphenyl)propanoate. InChIKey: XAAMAAXKDLWBKO-UHFFFAOYSA-N.
| Molecular formula | C17H18O3 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | methyl 3-(4-phenylmethoxyphenyl)propanoate |
| InChIKey | XAAMAAXKDLWBKO-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC1=CC=C(C=C1)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)