cas: 1451085-08-7 — see every product listed under this CAS number, including other names
Methyl 3-(4-bromophenyl)cyclobutanecarboxylate, 95%, 95% (CAS 1451085-08-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12B2AS-100mg |
| cas | 1451085-08-7 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1403.60 Pln | |
| Chemat | 250mg | 1970.00 Pln | |
| Chemat | 1g | 3870.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-(4-bromophenyl)cyclobutane-1-carboxylate (CAS 1451085-08-7) is a chemical compound with the molecular formula C12H13BrO2 and a molecular weight of 269.13 g/mol. IUPAC name: methyl 3-(4-bromophenyl)cyclobutane-1-carboxylate. InChIKey: BCNPYQCFSBDXKN-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO2 |
|---|---|
| Molecular weight | 269.13 g/mol |
| IUPAC name | methyl 3-(4-bromophenyl)cyclobutane-1-carboxylate |
| InChIKey | BCNPYQCFSBDXKN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC(C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)