Products 1820607-51-9

CAS 1820607-51-9 is the registry number for methyl 1-(3-bromophenyl)cyclobutane-1-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 1-(3-bromophenyl)cyclobutane-1-carboxylate (CAS 1820607-51-9) is a chemical compound with the molecular formula C12H13BrO2 and a molecular weight of 269.13 g/mol. IUPAC name: methyl 1-(3-bromophenyl)cyclobutane-1-carboxylate. InChIKey: JIJJFPCPCIAIRE-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13BrO2
Molecular weight269.13 g/mol
IUPAC namemethyl 1-(3-bromophenyl)cyclobutane-1-carboxylate
InChIKeyJIJJFPCPCIAIRE-UHFFFAOYSA-N
SMILESCOC(=O)C1(CCC1)C2=CC(=CC=C2)Br

Computed by PubChem (NCBI)