CAS 1082453-52-8 appears in our catalog under these names: (4-Bromophenyl)-cyclobutyl-acetic acid, 95%, 2-(4-Bromophenyl)-2-cyclobutylacetic acid, 97%, (4-Bromo-phenyl)-cyclobutyl-acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 0,5g.
2-(4-bromophenyl)-2-cyclobutylacetic acid (CAS 1082453-52-8) is a chemical compound with the molecular formula C12H13BrO2 and a molecular weight of 269.13 g/mol. IUPAC name: 2-(4-bromophenyl)-2-cyclobutylacetic acid. InChIKey: VBZOCDPAOXVRDX-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO2 |
|---|---|
| Molecular weight | 269.13 g/mol |
| IUPAC name | 2-(4-bromophenyl)-2-cyclobutylacetic acid |
| InChIKey | VBZOCDPAOXVRDX-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C(C2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)