Products 1565028-47-8

CAS 1565028-47-8 is the registry number for 3-(4-Bromophenyl)-2-cyclopropylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(4-bromophenyl)-2-cyclopropylpropanoic acid (CAS 1565028-47-8) is a chemical compound with the molecular formula C12H13BrO2 and a molecular weight of 269.13 g/mol. IUPAC name: 3-(4-bromophenyl)-2-cyclopropylpropanoic acid. InChIKey: XNOFBGXNVDTTCW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13BrO2
Molecular weight269.13 g/mol
IUPAC name3-(4-bromophenyl)-2-cyclopropylpropanoic acid
InChIKeyXNOFBGXNVDTTCW-UHFFFAOYSA-N
SMILESC1CC1C(CC2=CC=C(C=C2)Br)C(=O)O

Computed by PubChem (NCBI)