Products 1393444-15-9
CAS 1393444-15-9 is the registry number for (3E)-4-(3-Bromo-4-ethoxyphenyl)but-3-en-2-one, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.
(E)-4-(3-bromo-4-ethoxyphenyl)but-3-en-2-one (CAS 1393444-15-9) is a chemical compound with the molecular formula C12H13BrO2 and a molecular weight of 269.13 g/mol. IUPAC name: (E)-4-(3-bromo-4-ethoxyphenyl)but-3-en-2-one. InChIKey: CIZZFFZWNQBQGJ-SNAWJCMRSA-N.
| Molecular formula | C12H13BrO2 |
|---|---|
| Molecular weight | 269.13 g/mol |
| IUPAC name | (E)-4-(3-bromo-4-ethoxyphenyl)but-3-en-2-one |
| InChIKey | CIZZFFZWNQBQGJ-SNAWJCMRSA-N |
| SMILES | CCOC1=C(C=C(C=C1)/C=C/C(=O)C)Br |
Computed by PubChem (NCBI)