Methyl 3-Bromo-4-(trifluoromethyl)benzoate, 97%, 97%
cas: 455941-82-9 — see every product listed under this CAS number, including other names
Methyl 3-Bromo-4-(trifluoromethyl)benzoate, 97%, 97% (CAS 455941-82-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DHWN-1g |
| cas | 455941-82-9 |
| size | 1g |
| availability | 75g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 429.20 Pln | |
| Chemat | 10g | 717.20 Pln | |
| Chemat | 25g | 1552.40 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 107.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-bromo-4-(trifluoromethyl)benzoate (CAS 455941-82-9) is a chemical compound with the molecular formula C9H6BrF3O2 and a molecular weight of 283.04 g/mol. IUPAC name: methyl 3-bromo-4-(trifluoromethyl)benzoate. InChIKey: KRBIMWDSILHGKR-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O2 |
|---|---|
| Molecular weight | 283.04 g/mol |
| IUPAC name | methyl 3-bromo-4-(trifluoromethyl)benzoate |
| InChIKey | KRBIMWDSILHGKR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)