cas: 942077-15-8 — see every product listed under this CAS number, including other names
Methyl 3-Cyano-5-(trifluoromethyl)benzoate, ≥97%, ≥97% (CAS 942077-15-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DER7-100mg |
| cas | 942077-15-8 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 578.00 Pln | |
| Chemat | 5g | 1782.80 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-cyano-5-(trifluoromethyl)benzoate (CAS 942077-15-8) is a chemical compound with the molecular formula C10H6F3NO2 and a molecular weight of 229.15 g/mol. IUPAC name: methyl 3-cyano-5-(trifluoromethyl)benzoate. InChIKey: BGUJITPVPBBWEW-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO2 |
|---|---|
| Molecular weight | 229.15 g/mol |
| IUPAC name | methyl 3-cyano-5-(trifluoromethyl)benzoate |
| InChIKey | BGUJITPVPBBWEW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C#N)C(F)(F)F |
Computed by PubChem (NCBI)