cas: 1036380-75-2 — see every product listed under this CAS number, including other names
Methyl 3-amino-5-bromobenzo[b]thiophene-2-carboxylate, 97% (CAS 1036380-75-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F613768-1G |
| cas | 1036380-75-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 284.29 Pln | |
| Fluorochem | 5g | 1112.13 Pln | |
| Fluorochem | 10g | 1757.73 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-amino-5-bromo-1-benzothiophene-2-carboxylate (CAS 1036380-75-2) is a chemical compound with the molecular formula C10H8BrNO2S and a molecular weight of 286.15 g/mol. IUPAC name: methyl 3-amino-5-bromo-1-benzothiophene-2-carboxylate. InChIKey: WJWGIMBQYSUCBO-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2S |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | methyl 3-amino-5-bromo-1-benzothiophene-2-carboxylate |
| InChIKey | WJWGIMBQYSUCBO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(S1)C=CC(=C2)Br)N |
Computed by PubChem (NCBI)