Products 1384191-70-1
CAS 1384191-70-1 is the registry number for 5-Bromo-2-(3-methoxyphenoxy)-1,3-thiazole, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-bromo-2-(3-methoxyphenoxy)-1,3-thiazole (CAS 1384191-70-1) is a chemical compound with the molecular formula C10H8BrNO2S and a molecular weight of 286.15 g/mol. IUPAC name: 5-bromo-2-(3-methoxyphenoxy)-1,3-thiazole. InChIKey: DEDMUARICMOEQL-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2S |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | 5-bromo-2-(3-methoxyphenoxy)-1,3-thiazole |
| InChIKey | DEDMUARICMOEQL-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC=C1)OC2=NC=C(S2)Br |
Computed by PubChem (NCBI)