CAS 858671-74-6 is the registry number for Ethyl 6-bromobenzo[d]isothiazole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 6-bromo-1,2-benzothiazole-3-carboxylate (CAS 858671-74-6) is a chemical compound with the molecular formula C10H8BrNO2S and a molecular weight of 286.15 g/mol. IUPAC name: ethyl 6-bromo-1,2-benzothiazole-3-carboxylate. InChIKey: ZMOIGRSGHBJKSS-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2S |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | ethyl 6-bromo-1,2-benzothiazole-3-carboxylate |
| InChIKey | ZMOIGRSGHBJKSS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NSC2=C1C=CC(=C2)Br |
Computed by PubChem (NCBI)