CAS 1823516-34-2 is the registry number for 4-Bromo-3-thiocyanato-benzoic acid ethyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g, 250mg.
Ethyl 4-bromo-3-thiocyanatobenzoate (CAS 1823516-34-2) is a chemical compound with the molecular formula C10H8BrNO2S and a molecular weight of 286.15 g/mol. IUPAC name: ethyl 4-bromo-3-thiocyanatobenzoate. InChIKey: MWKJXMRYBXYUFB-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2S |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | ethyl 4-bromo-3-thiocyanatobenzoate |
| InChIKey | MWKJXMRYBXYUFB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)Br)SC#N |
Computed by PubChem (NCBI)