Products 1234615-97-4
CAS 1234615-97-4 is the registry number for Ethyl 5-bromothieno[2,3-b]pyridine-2-carboxylate, 97%. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 5g, 1g, 100mg.
Ethyl 5-bromothieno[2,3-b]pyridine-2-carboxylate (CAS 1234615-97-4) is a chemical compound with the molecular formula C10H8BrNO2S and a molecular weight of 286.15 g/mol. IUPAC name: ethyl 5-bromothieno[2,3-b]pyridine-2-carboxylate. InChIKey: WBSNEQKCHKDKHK-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2S |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | ethyl 5-bromothieno[2,3-b]pyridine-2-carboxylate |
| InChIKey | WBSNEQKCHKDKHK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=CC(=CN=C2S1)Br |
Computed by PubChem (NCBI)