cas: 113899-36-8 — see every product listed under this CAS number, including other names
Methyl 3-amino-5-nitrothiophene-2-carboxylate, 97% (CAS 113899-36-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F640479-50MG |
| cas | 113899-36-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 284.29 Pln | |
| Fluorochem | 100mg | 502.97 Pln | |
| Fluorochem | 250mg | 815.36 Pln | |
| Fluorochem | 500mg | 1289.15 Pln | |
| Fluorochem | 1g | 1580.71 Pln | |
| Fluorochem | 2.5g | 3876.78 Pln | |
| Fluorochem | 5g | 6386.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-amino-5-nitrothiophene-2-carboxylate (CAS 113899-36-8) is a chemical compound with the molecular formula C6H6N2O4S and a molecular weight of 202.19 g/mol. IUPAC name: methyl 3-amino-5-nitrothiophene-2-carboxylate. InChIKey: WUOQQUBKJDJZJY-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4S |
|---|---|
| Molecular weight | 202.19 g/mol |
| IUPAC name | methyl 3-amino-5-nitrothiophene-2-carboxylate |
| InChIKey | WUOQQUBKJDJZJY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(S1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)