cas: 1017782-63-6 — see every product listed under this CAS number, including other names
Methyl 3-amino-6-bromo-1-benzothiophene-2-carboxylate, 98% (CAS 1017782-63-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F639561-250MG |
| cas | 1017782-63-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 500mg | 325.94 Pln | |
| Fluorochem | 1g | 456.11 Pln | |
| Fluorochem | 2.5g | 1060.06 Pln | |
| Fluorochem | 5g | 1341.21 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-amino-6-bromo-1-benzothiophene-2-carboxylate (CAS 1017782-63-6) is a chemical compound with the molecular formula C10H8BrNO2S and a molecular weight of 286.15 g/mol. IUPAC name: methyl 3-amino-6-bromo-1-benzothiophene-2-carboxylate. InChIKey: PZARJZCGTKHODQ-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2S |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | methyl 3-amino-6-bromo-1-benzothiophene-2-carboxylate |
| InChIKey | PZARJZCGTKHODQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(S1)C=C(C=C2)Br)N |
Computed by PubChem (NCBI)