Methyl 3-bromo-2,6-dimethylbenzoate, 97%
cas: 86246-71-1 — see every product listed under this CAS number, including other names
Methyl 3-bromo-2,6-dimethylbenzoate, 97% (CAS 86246-71-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A904450-250mg |
| cas | 86246-71-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 559.50 Pln | |
| Ambeed | 10g | 915.50 Pln | |
| Ambeed | 25g | 2078.06 Pln | |
| Ambeed | 100g | 7351.31 Pln | |
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 575.86 Pln | |
| Fluorochem | 10g | 945.52 Pln | |
| Fluorochem | 25g | 2132.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 3-bromo-2,6-dimethylbenzoate (CAS 86246-71-1) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: methyl 3-bromo-2,6-dimethylbenzoate. InChIKey: PAAMRJWZTZAXAO-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | methyl 3-bromo-2,6-dimethylbenzoate |
| InChIKey | PAAMRJWZTZAXAO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Br)C)C(=O)OC |
Computed by PubChem (NCBI)