Products 86246-71-1
CAS 86246-71-1 appears in our catalog under these names: Methyl 3-bromo-2,6-dimethylbenzoate, 95%, Methyl 3–bromo–2，6–dimethylbenzoate, Methyl 3-bromo-2,6-dimethylbenzoate, Methyl 3-bromo-2,6-dimethylbenzoate 97%, Methyl 3-bromo-2,6-dimethylbenzoate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg, 25g, 100mg.
Methyl 3-bromo-2,6-dimethylbenzoate (CAS 86246-71-1) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: methyl 3-bromo-2,6-dimethylbenzoate. InChIKey: PAAMRJWZTZAXAO-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | methyl 3-bromo-2,6-dimethylbenzoate |
| InChIKey | PAAMRJWZTZAXAO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Br)C)C(=O)OC |
Computed by PubChem (NCBI)